C22H20O8 — CID 14864186
methyl 2-[4,5,8-trihydroxy-9,10-dioxo-3-(3-oxopentyl)anthracen-2-yl]acetate (PubChem CID 14864186) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is methyl 2-[4,5,8-trihydroxy-9,10-dioxo-3-(3-oxopentyl)anthracen-2-yl]acetate.
| Compound Name | methyl 2-[4,5,8-trihydroxy-9,10-dioxo-3-(3-oxopentyl)anthracen-2-yl]acetate |
|---|---|
| PubChem CID | 14864186 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl 2-[4,5,8-trihydroxy-9,10-dioxo-3-(3-oxopentyl)anthracen-2-yl]acetate |
| SMILES | CCC(=O)CCc1c(CC(=O)OC)cc2c(c1O)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C22H20O8/c1-3-11(23)4-5-12-10(9-16(26)30-2)8-13-17(20(12)27)22(29)19-15(25)7-6-14(24)18(19)21(13)28/h6-8,24-25,27H,3-5,9H2,1-2H3 |
| InChIKey | DLRSKUOAFPNFLC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|