C15H11BrO6 — CID 14786570
methyl 4-(3-bromo-5-hydroxy-1,4-dioxonaphthalen-2-yl)-3-oxobutanoate (PubChem CID 14786570) has the molecular formula C15H11BrO6 and a molecular weight of 367.15 g/mol. Its IUPAC name is methyl 4-(3-bromo-5-hydroxy-1,4-dioxonaphthalen-2-yl)-3-oxobutanoate.
| Compound Name | methyl 4-(3-bromo-5-hydroxy-1,4-dioxonaphthalen-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 14786570 |
| Molecular Formula | C15H11BrO6 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | methyl 4-(3-bromo-5-hydroxy-1,4-dioxonaphthalen-2-yl)-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CC1=C(Br)C(=O)c2c(O)cccc2C1=O |
| InChI | InChI=1S/C15H11BrO6/c1-22-11(19)6-7(17)5-9-13(16)15(21)12-8(14(9)20)3-2-4-10(12)18/h2-4,18H,5-6H2,1H3 |
| InChIKey | GZMABDNNUDOGIV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|