C13H10O5 — CID 14378524
4,8-dihydroxy-3-(2-oxopropyl)naphthalene-1,2-dione (PubChem CID 14378524) has the molecular formula C13H10O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is 4,8-dihydroxy-3-(2-oxopropyl)naphthalene-1,2-dione.
| Compound Name | 4,8-dihydroxy-3-(2-oxopropyl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 14378524 |
| Molecular Formula | C13H10O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 4,8-dihydroxy-3-(2-oxopropyl)naphthalene-1,2-dione |
| SMILES | CC(=O)CC1=C(O)c2cccc(O)c2C(=O)C1=O |
| InChI | InChI=1S/C13H10O5/c1-6(14)5-8-11(16)7-3-2-4-9(15)10(7)13(18)12(8)17/h2-4,15-16H,5H2,1H3 |
| InChIKey | UCYYUJNBNXVWCY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|