About methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate
methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate (PubChem CID 14378521) has the molecular formula C15H14O7
and a molecular weight of 306.27 g/mol. Its IUPAC name is methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate.
Molecular Properties
| Compound Name | methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate |
| PubChem CID | 14378521 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate |
| SMILES | COC(=O)CC(O)CC1=C(O)c2cccc(O)c2C(=O)C1=O |
| InChI | InChI=1S/C15H14O7/c1-22-11(18)6-7(16)5-9-13(19)8-3-2-4-10(17)12(8)15(21)14(9)20/h2-4,7,16-17,19H,5-6H2,1H3 |
| InChIKey | JRPFXRHZPSMWBG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate?
The IUPAC name of methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate (CID 14378521) is methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate.
What is the SMILES notation for methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate?
The canonical SMILES for methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate is COC(=O)CC(O)CC1=C(O)c2cccc(O)c2C(=O)C1=O.
What is the InChIKey of methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate?
The InChIKey is JRPFXRHZPSMWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O7/c1-22-11(18)6-7(16)5-9-13(19)8-3-2-4-10(17)12(8)15(21)14(9)20/h2-4,7,16-17,19H,5-6H2,1H3.
What are the key properties of methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate?
methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate has a molecular weight of 306.27 g/mol, XLogP of 0.74, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,5-dihydroxy-3,4-dioxonaphthalen-2-yl)-3-hydroxybutanoate is sourced from PubChem (CID 14378521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).