C23H21BrO8 — CID 10815409
2-bromo-1,5-dihydroxy-7-methoxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione (PubChem CID 10815409) has the molecular formula C23H21BrO8 and a molecular weight of 505.32 g/mol. Its IUPAC name is 2-bromo-1,5-dihydroxy-7-methoxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione.
| Compound Name | 2-bromo-1,5-dihydroxy-7-methoxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 10815409 |
| Molecular Formula | C23H21BrO8 |
| Molecular Weight | 505.32 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 2-bromo-1,5-dihydroxy-7-methoxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1c(cc(CCC(=O)CC3(C)OCCO3)c(Br)c1O)C2=O |
| InChI | InChI=1S/C23H21BrO8/c1-23(31-5-6-32-23)10-12(25)4-3-11-7-14-18(22(29)19(11)24)21(28)15-8-13(30-2)9-16(26)17(15)20(14)27/h7-9,26,29H,3-6,10H2,1-2H3 |
| InChIKey | CRQWEAQNSDLVHN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|