C26H30O7 — CID 130194205
(10R)-1,11-dihydroxy-3,9-dimethoxy-8,8,9-trimethyl-10-propan-2-yloxy-7,10-dihydrotetracene-5,12-dione (PubChem CID 130194205) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is (10R)-1,11-dihydroxy-3,9-dimethoxy-8,8,9-trimethyl-10-propan-2-yloxy-7,10-dihydrotetracene-5,12-dione.
| Compound Name | (10R)-1,11-dihydroxy-3,9-dimethoxy-8,8,9-trimethyl-10-propan-2-yloxy-7,10-dihydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 130194205 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (10R)-1,11-dihydroxy-3,9-dimethoxy-8,8,9-trimethyl-10-propan-2-yloxy-7,10-dihydrotetracene-5,12-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc3c(c(O)c1C2=O)[C@@H](OC(C)C)C(C)(OC)C(C)(C)C3 |
| InChI | InChI=1S/C26H30O7/c1-12(2)33-24-18-13(11-25(3,4)26(24,5)32-7)8-15-20(22(18)29)23(30)19-16(21(15)28)9-14(31-6)10-17(19)27/h8-10,12,24,27,29H,11H2,1-7H3/t24-,26?/m1/s1 |
| InChIKey | GTYASUOJONCYLI-RMVMEJTISA-N |
| XLogP | 4.34 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|