C21H18O7 — CID 70396475
(7S,9R)-9-acetyl-6,7,9-trihydroxy-2-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 70396475) has the molecular formula C21H18O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is (7S,9R)-9-acetyl-6,7,9-trihydroxy-2-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9R)-9-acetyl-6,7,9-trihydroxy-2-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 70396475 |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (7S,9R)-9-acetyl-6,7,9-trihydroxy-2-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1cc3c(c(O)c1C2=O)[C@@H](O)C[C@@](O)(C(C)=O)C3 |
| InChI | InChI=1S/C21H18O7/c1-9(22)21(27)7-10-5-14-17(20(26)16(10)15(23)8-21)19(25)12-4-3-11(28-2)6-13(12)18(14)24/h3-6,15,23,26-27H,7-8H2,1-2H3/t15-,21+/m0/s1 |
| InChIKey | XAXDEAZXHYBQTQ-YCRPNKLZSA-N |
| XLogP | 1.48 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|