C24H26O8 — CID 130194203
(7R,8S,9R)-4,6,9-trihydroxy-2,8-dimethoxy-9-methyl-7-propan-2-yloxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 130194203) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is (7R,8S,9R)-4,6,9-trihydroxy-2,8-dimethoxy-9-methyl-7-propan-2-yloxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R,8S,9R)-4,6,9-trihydroxy-2,8-dimethoxy-9-methyl-7-propan-2-yloxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 130194203 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (7R,8S,9R)-4,6,9-trihydroxy-2,8-dimethoxy-9-methyl-7-propan-2-yloxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc3c(c(O)c1C2=O)[C@@H](OC(C)C)[C@H](OC)[C@](C)(O)C3 |
| InChI | InChI=1S/C24H26O8/c1-10(2)32-22-16-11(9-24(3,29)23(22)31-5)6-13-18(20(16)27)21(28)17-14(19(13)26)7-12(30-4)8-15(17)25/h6-8,10,22-23,25,27,29H,9H2,1-5H3/t22-,23+,24-/m1/s1 |
| InChIKey | MNMVXMLDZHFHJK-TZRRMPRUSA-N |
| XLogP | 2.67 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|