C19H16O6 — CID 67808415
2,3-dihydroxy-4-(hydroxymethyl)-9-methoxy-2,3-dihydro-1H-cyclopenta[a]anthracene-6,11-dione (PubChem CID 67808415) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(hydroxymethyl)-9-methoxy-2,3-dihydro-1H-cyclopenta[a]anthracene-6,11-dione.
| Compound Name | 2,3-dihydroxy-4-(hydroxymethyl)-9-methoxy-2,3-dihydro-1H-cyclopenta[a]anthracene-6,11-dione |
|---|---|
| PubChem CID | 67808415 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,3-dihydroxy-4-(hydroxymethyl)-9-methoxy-2,3-dihydro-1H-cyclopenta[a]anthracene-6,11-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1c(cc(CO)c3c1CC(O)C3O)C2=O |
| InChI | InChI=1S/C19H16O6/c1-25-9-2-3-10-11(5-9)18(23)16-12-6-14(21)19(24)15(12)8(7-20)4-13(16)17(10)22/h2-5,14,19-21,24H,6-7H2,1H3 |
| InChIKey | AWLLWNWTSDWKLC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|