C19H15NO6 — CID 19000563
[3-hydroxy-4-(hydroxymethyl)-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] carbamate (PubChem CID 19000563) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is [3-hydroxy-4-(hydroxymethyl)-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] carbamate.
| Compound Name | [3-hydroxy-4-(hydroxymethyl)-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] carbamate |
|---|---|
| PubChem CID | 19000563 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [3-hydroxy-4-(hydroxymethyl)-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] carbamate |
| SMILES | NC(=O)OC1Cc2c3c(cc(CO)c2C1O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C19H15NO6/c20-19(25)26-13-6-11-14(18(13)24)8(7-21)5-12-15(11)17(23)10-4-2-1-3-9(10)16(12)22/h1-5,13,18,21,24H,6-7H2,(H2,20,25) |
| InChIKey | DJNZKZMJLDJNGR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|