C29H26O6 — CID 10742987
10-[(4-methoxyphenyl)methoxymethyl]-6,6-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1(12),2(9),10,14,16,18-hexaene-13,20-dione (PubChem CID 10742987) has the molecular formula C29H26O6 and a molecular weight of 470.52 g/mol. Its IUPAC name is 10-[(4-methoxyphenyl)methoxymethyl]-6,6-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1(12),2(9),10,14,16,18-hexaene-13,20-dione.
| Compound Name | 10-[(4-methoxyphenyl)methoxymethyl]-6,6-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1(12),2(9),10,14,16,18-hexaene-13,20-dione |
|---|---|
| PubChem CID | 10742987 |
| Molecular Formula | C29H26O6 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 10-[(4-methoxyphenyl)methoxymethyl]-6,6-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1(12),2(9),10,14,16,18-hexaene-13,20-dione |
| SMILES | COc1ccc(COCc2cc3c(c4c2C2OC(C)(C)OC2C4)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C29H26O6/c1-29(2)34-23-13-21-24(28(23)35-29)17(15-33-14-16-8-10-18(32-3)11-9-16)12-22-25(21)27(31)20-7-5-4-6-19(20)26(22)30/h4-12,23,28H,13-15H2,1-3H3 |
| InChIKey | BSZDLUGPRUJZSF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|