C23H28O5 — CID 24970366
1-[5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]but-3-en-2-ol (PubChem CID 24970366) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-[5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]but-3-en-2-ol.
| Compound Name | 1-[5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 24970366 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]but-3-en-2-ol |
| SMILES | C=CC(O)CC1OC(C)(C)Oc2cccc(COCc3ccc(OC)cc3)c21 |
| InChI | InChI=1S/C23H28O5/c1-5-18(24)13-21-22-17(7-6-8-20(22)27-23(2,3)28-21)15-26-14-16-9-11-19(25-4)12-10-16/h5-12,18,21,24H,1,13-15H2,2-4H3 |
| InChIKey | CQXURMWBKHGXGQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|