C20H24O6 — CID 11494234
(3aR,6R,7aR)-6-[4-[(4-methoxyphenyl)methoxy]but-2-ynyl]-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one (PubChem CID 11494234) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (3aR,6R,7aR)-6-[4-[(4-methoxyphenyl)methoxy]but-2-ynyl]-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one.
| Compound Name | (3aR,6R,7aR)-6-[4-[(4-methoxyphenyl)methoxy]but-2-ynyl]-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
|---|---|
| PubChem CID | 11494234 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (3aR,6R,7aR)-6-[4-[(4-methoxyphenyl)methoxy]but-2-ynyl]-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
| SMILES | COc1ccc(COCC#CC[C@H]2OC[C@H]3OC(C)(C)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C20H24O6/c1-20(2)25-17-13-24-16(18(21)19(17)26-20)6-4-5-11-23-12-14-7-9-15(22-3)10-8-14/h7-10,16-17,19H,6,11-13H2,1-3H3/t16-,17-,19-/m1/s1 |
| InChIKey | CFNRQGCHKPWQOB-ZHALLVOQSA-N |
| XLogP | 2.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|