C20H17N3O7S — CID 19000697
[3-azido-4-(hydroxymethyl)-8-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate (PubChem CID 19000697) has the molecular formula C20H17N3O7S and a molecular weight of 443.44 g/mol. Its IUPAC name is [3-azido-4-(hydroxymethyl)-8-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate.
| Compound Name | [3-azido-4-(hydroxymethyl)-8-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 19000697 |
| Molecular Formula | C20H17N3O7S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | [3-azido-4-(hydroxymethyl)-8-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate |
| SMILES | COc1ccc2c(c1)C(=O)c1cc(CO)c3c(c1C2=O)CC(OS(C)(=O)=O)C3N=[N+]=[N-] |
| InChI | InChI=1S/C20H17N3O7S/c1-29-10-3-4-11-12(6-10)19(25)14-5-9(8-24)16-13(17(14)20(11)26)7-15(18(16)22-23-21)30-31(2,27)28/h3-6,15,18,24H,7-8H2,1-2H3 |
| InChIKey | MRVXPKNTPGDBAH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|