C14H19N3O4S — CID 10064893
[(1R,2S,4R)-4-azido-2-(4-methoxyphenyl)cyclohexyl] methanesulfonate (PubChem CID 10064893) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is [(1R,2S,4R)-4-azido-2-(4-methoxyphenyl)cyclohexyl] methanesulfonate.
| Compound Name | [(1R,2S,4R)-4-azido-2-(4-methoxyphenyl)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 10064893 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [(1R,2S,4R)-4-azido-2-(4-methoxyphenyl)cyclohexyl] methanesulfonate |
| SMILES | COc1ccc([C@@H]2C[C@H](N=[N+]=[N-])CC[C@H]2OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19N3O4S/c1-20-12-6-3-10(4-7-12)13-9-11(16-17-15)5-8-14(13)21-22(2,18)19/h3-4,6-7,11,13-14H,5,8-9H2,1-2H3/t11-,13+,14-/m1/s1 |
| InChIKey | UNWYJPXUNVMDBL-KWCYVHTRSA-N |
| XLogP | 2.99 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|