C22H22N4O9S — CID 19000665
[3-azido-4-(hydroxymethyl)-9-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate;methylcarbamic acid (PubChem CID 19000665) has the molecular formula C22H22N4O9S and a molecular weight of 518.50 g/mol. Its IUPAC name is [3-azido-4-(hydroxymethyl)-9-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate;methylcarbamic acid.
| Compound Name | [3-azido-4-(hydroxymethyl)-9-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate;methylcarbamic acid |
|---|---|
| PubChem CID | 19000665 |
| Molecular Formula | C22H22N4O9S |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | [3-azido-4-(hydroxymethyl)-9-methoxy-6,11-dioxo-2,3-dihydro-1H-cyclopenta[a]anthracen-2-yl] methanesulfonate;methylcarbamic acid |
| SMILES | CNC(=O)O.COc1ccc2c(c1)C(=O)c1c(cc(CO)c3c1CC(OS(C)(=O)=O)C3N=[N+]=[N-])C2=O |
| InChI | InChI=1S/C20H17N3O7S.C2H5NO2/c1-29-10-3-4-11-12(6-10)20(26)17-13-7-15(30-31(2,27)28)18(22-23-21)16(13)9(8-24)5-14(17)19(11)25;1-3-2(4)5/h3-6,15,18,24H,7-8H2,1-2H3;3H,1H3,(H,4,5) |
| InChIKey | COWWVUJSMWQMGR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 205.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|