C11H8O4 — CID 23147999
(2Z)-2-(hydroxymethylidene)-5-methoxyindene-1,3-dione (PubChem CID 23147999) has the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. Its IUPAC name is (2Z)-2-(hydroxymethylidene)-5-methoxyindene-1,3-dione.
| Compound Name | (2Z)-2-(hydroxymethylidene)-5-methoxyindene-1,3-dione |
|---|---|
| PubChem CID | 23147999 |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (2Z)-2-(hydroxymethylidene)-5-methoxyindene-1,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)/C(=C\O)C2=O |
| InChI | InChI=1S/C11H8O4/c1-15-6-2-3-7-8(4-6)11(14)9(5-12)10(7)13/h2-5,12H,1H3/b9-5- |
| InChIKey | HRNOKPGZPZPAPU-UITAMQMPSA-N |
| XLogP | 1.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|