C10H10ClNO3 — CID 134294937
[(1R,2S)-7-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl] carbamate (PubChem CID 134294937) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is [(1R,2S)-7-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl] carbamate.
| Compound Name | [(1R,2S)-7-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl] carbamate |
|---|---|
| PubChem CID | 134294937 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [(1R,2S)-7-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1c2c(Cl)cccc2C[C@@H]1O |
| InChI | InChI=1S/C10H10ClNO3/c11-6-3-1-2-5-4-7(13)9(8(5)6)15-10(12)14/h1-3,7,9,13H,4H2,(H2,12,14)/t7-,9-/m0/s1 |
| InChIKey | YFOZSRHPRFAOHL-CBAPKCEASA-N |
| XLogP | 1.39 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |