C21H14Cl2O2 — CID 101140258
(1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate (PubChem CID 101140258) has the molecular formula C21H14Cl2O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate.
| Compound Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate |
|---|---|
| PubChem CID | 101140258 |
| Molecular Formula | C21H14Cl2O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate |
| SMILES | O=C(OC1c2c(Cl)cccc2Cc2cccc(Cl)c21)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2O2/c22-16-10-4-8-14-12-15-9-5-11-17(23)19(15)20(18(14)16)25-21(24)13-6-2-1-3-7-13/h1-11,20H,12H2 |
| InChIKey | QDKGEAHDANZKKQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |