About (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate
(1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate (PubChem CID 101140258) has the molecular formula C21H14Cl2O2
and a molecular weight of 369.25 g/mol. Its IUPAC name is (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate.
Molecular Properties
| Compound Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate |
| PubChem CID | 101140258 |
| Molecular Formula | C21H14Cl2O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate |
| SMILES | O=C(OC1c2c(Cl)cccc2Cc2cccc(Cl)c21)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2O2/c22-16-10-4-8-14-12-15-9-5-11-17(23)19(15)20(18(14)16)25-21(24)13-6-2-1-3-7-13/h1-11,20H,12H2 |
| InChIKey | QDKGEAHDANZKKQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate?
The IUPAC name of (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate (CID 101140258) is (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate.
What is the SMILES notation for (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate?
The canonical SMILES for (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate is O=C(OC1c2c(Cl)cccc2Cc2cccc(Cl)c21)c1ccccc1.
What is the InChIKey of (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate?
The InChIKey is QDKGEAHDANZKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14Cl2O2/c22-16-10-4-8-14-12-15-9-5-11-17(23)19(15)20(18(14)16)25-21(24)13-6-2-1-3-7-13/h1-11,20H,12H2.
What are the key properties of (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate?
(1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate has a molecular weight of 369.25 g/mol, XLogP of 5.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,8-dichloro-9,10-dihydroanthracen-9-yl) benzoate is sourced from PubChem (CID 101140258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).