C21H12Cl4O2 — CID 101140266
(1,8-dichloro-9,10-dihydroanthracen-9-yl) 2,4-dichlorobenzoate (PubChem CID 101140266) has the molecular formula C21H12Cl4O2 and a molecular weight of 438.14 g/mol. Its IUPAC name is (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2,4-dichlorobenzoate.
| Compound Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 101140266 |
| Molecular Formula | C21H12Cl4O2 |
| Molecular Weight | 438.14 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | (1,8-dichloro-9,10-dihydroanthracen-9-yl) 2,4-dichlorobenzoate |
| SMILES | O=C(OC1c2c(Cl)cccc2Cc2cccc(Cl)c21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H12Cl4O2/c22-13-7-8-14(17(25)10-13)21(26)27-20-18-11(3-1-5-15(18)23)9-12-4-2-6-16(24)19(12)20/h1-8,10,20H,9H2 |
| InChIKey | HYYAEDYFYIJMSU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.14 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |