C23H14BrNO3 — CID 102460167
[5-(4-bromophenyl)-10-oxoindeno[1,2-b]indol-9-yl] acetate (PubChem CID 102460167) has the molecular formula C23H14BrNO3 and a molecular weight of 432.27 g/mol. Its IUPAC name is [5-(4-bromophenyl)-10-oxoindeno[1,2-b]indol-9-yl] acetate.
| Compound Name | [5-(4-bromophenyl)-10-oxoindeno[1,2-b]indol-9-yl] acetate |
|---|---|
| PubChem CID | 102460167 |
| Molecular Formula | C23H14BrNO3 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | [5-(4-bromophenyl)-10-oxoindeno[1,2-b]indol-9-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1c1c(n2-c2ccc(Br)cc2)-c2ccccc2C1=O |
| InChI | InChI=1S/C23H14BrNO3/c1-13(26)28-19-8-4-7-18-20(19)21-22(16-5-2-3-6-17(16)23(21)27)25(18)15-11-9-14(24)10-12-15/h2-12H,1H3 |
| InChIKey | ORGYSCHEETZOPD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|