C22H12FNO2 — CID 138585218
6-(4-fluorophenyl)indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 138585218) has the molecular formula C22H12FNO2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 6-(4-fluorophenyl)indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(4-fluorophenyl)indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 138585218 |
| Molecular Formula | C22H12FNO2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 6-(4-fluorophenyl)indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | O=C1c2ccccc2-c2c1c1ccccc1c(=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H12FNO2/c23-13-9-11-14(12-10-13)24-20-16-6-2-3-7-17(16)21(25)19(20)15-5-1-4-8-18(15)22(24)26/h1-12H |
| InChIKey | TTWNKIZTNJIYLM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|