C26H19NO4 — CID 51057193
2-[4-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)phenyl]butanoic acid (PubChem CID 51057193) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[4-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)phenyl]butanoic acid.
| Compound Name | 2-[4-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 51057193 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[4-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(-n2c3c(c4ccccc4c2=O)C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C26H19NO4/c1-2-17(26(30)31)15-11-13-16(14-12-15)27-23-19-8-4-5-9-20(19)24(28)22(23)18-7-3-6-10-21(18)25(27)29/h3-14,17H,2H2,1H3,(H,30,31) |
| InChIKey | PDULCNVEIYYULU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|