C18H18N2O6 — CID 56652366
nitric acid;2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid (PubChem CID 56652366) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is nitric acid;2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid.
| Compound Name | nitric acid;2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 56652366 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | nitric acid;2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C18H17NO3.HNO3/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20;2-1(3)4/h3-10,15H,2,11H2,1H3,(H,21,22);(H,2,3,4) |
| InChIKey | SCTHSEWQFNYSBG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|