About butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid
butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid (PubChem CID 56652023) has the molecular formula C22H23NO7
and a molecular weight of 413.43 g/mol. Its IUPAC name is butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid.
Molecular Properties
| Compound Name | butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
| PubChem CID | 56652023 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
| SMILES | CC[C@H](C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C18H17NO3.C4H6O4/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20;5-3(6)1-2-4(7)8/h3-10,15H,2,11H2,1H3,(H,21,22);1-2H2,(H,5,6)(H,7,8)/t15-;/m0./s1 |
| InChIKey | SVYVCSKDWDYBSA-RSAXXLAASA-N |
| XLogP | 3.36 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid?
The IUPAC name of butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid (CID 56652023) is butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid.
What is the SMILES notation for butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid?
The canonical SMILES for butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid is CC[C@H](C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid?
The InChIKey is SVYVCSKDWDYBSA-RSAXXLAASA-N. The full InChI is InChI=1S/C18H17NO3.C4H6O4/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20;5-3(6)1-2-4(7)8/h3-10,15H,2,11H2,1H3,(H,21,22);1-2H2,(H,5,6)(H,7,8)/t15-;/m0./s1.
What are the key properties of butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid?
butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid has a molecular weight of 413.43 g/mol, XLogP of 3.36, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid is sourced from PubChem (CID 56652023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).