C22H23NO7 — CID 56652023
butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid (PubChem CID 56652023) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid.
| Compound Name | butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 56652023 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | butanedioic acid;(2S)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
| SMILES | CC[C@H](C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C18H17NO3.C4H6O4/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20;5-3(6)1-2-4(7)8/h3-10,15H,2,11H2,1H3,(H,21,22);1-2H2,(H,5,6)(H,7,8)/t15-;/m0./s1 |
| InChIKey | SVYVCSKDWDYBSA-RSAXXLAASA-N |
| XLogP | 3.36 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |