C31H18FNO3 — CID 72702433
3-benzoyl-1-(4-fluorophenyl)-2-phenylbenzo[f]indole-4,9-dione (PubChem CID 72702433) has the molecular formula C31H18FNO3 and a molecular weight of 471.49 g/mol. Its IUPAC name is 3-benzoyl-1-(4-fluorophenyl)-2-phenylbenzo[f]indole-4,9-dione.
| Compound Name | 3-benzoyl-1-(4-fluorophenyl)-2-phenylbenzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 72702433 |
| Molecular Formula | C31H18FNO3 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 3-benzoyl-1-(4-fluorophenyl)-2-phenylbenzo[f]indole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(C(=O)c1ccccc1)c(-c1ccccc1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C31H18FNO3/c32-21-15-17-22(18-16-21)33-27(19-9-3-1-4-10-19)25(29(34)20-11-5-2-6-12-20)26-28(33)31(36)24-14-8-7-13-23(24)30(26)35/h1-18H |
| InChIKey | BAOUSLYZJXIYNN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|