C17H11Br2NO3 — CID 142666976
3-benzoyl-5,6-dibromo-1,2-dimethylindole-4,7-dione (PubChem CID 142666976) has the molecular formula C17H11Br2NO3 and a molecular weight of 437.09 g/mol. Its IUPAC name is 3-benzoyl-5,6-dibromo-1,2-dimethylindole-4,7-dione.
| Compound Name | 3-benzoyl-5,6-dibromo-1,2-dimethylindole-4,7-dione |
|---|---|
| PubChem CID | 142666976 |
| Molecular Formula | C17H11Br2NO3 |
| Molecular Weight | 437.09 g/mol |
| Exact Mass | 434.91 |
| IUPAC Name | 3-benzoyl-5,6-dibromo-1,2-dimethylindole-4,7-dione |
| SMILES | Cc1c(C(=O)c2ccccc2)c2c(n1C)C(=O)C(Br)=C(Br)C2=O |
| InChI | InChI=1S/C17H11Br2NO3/c1-8-10(15(21)9-6-4-3-5-7-9)11-14(20(8)2)17(23)13(19)12(18)16(11)22/h3-7H,1-2H3 |
| InChIKey | OKPBLHQGYZKZSI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.09 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|