C20H18N2O6S — CID 7475283
(4-benzoylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate (PubChem CID 7475283) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is (4-benzoylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate.
| Compound Name | (4-benzoylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
|---|---|
| PubChem CID | 7475283 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (4-benzoylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
| SMILES | Cc1c(S(=O)(=O)Oc2ccc(C(=O)c3ccccc3)cc2)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C20H18N2O6S/c1-13-18(19(24)22(3)20(25)21(13)2)29(26,27)28-16-11-9-15(10-12-16)17(23)14-7-5-4-6-8-14/h4-12H,1-3H3 |
| InChIKey | MGWMOWPFIPDVGC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|