C14H14N2O7S — CID 7475298
1,3-benzodioxol-5-yl 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate (PubChem CID 7475298) has the molecular formula C14H14N2O7S and a molecular weight of 354.34 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate.
| Compound Name | 1,3-benzodioxol-5-yl 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
|---|---|
| PubChem CID | 7475298 |
| Molecular Formula | C14H14N2O7S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
| SMILES | Cc1c(S(=O)(=O)Oc2ccc3c(c2)OCO3)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H14N2O7S/c1-8-12(13(17)16(3)14(18)15(8)2)24(19,20)23-9-4-5-10-11(6-9)22-7-21-10/h4-6H,7H2,1-3H3 |
| InChIKey | PZFKHAGWGZKJLY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|