C14H15N3O4 — CID 28619927
5-[(1,3-benzodioxol-5-ylamino)methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 28619927) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-[(1,3-benzodioxol-5-ylamino)methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[(1,3-benzodioxol-5-ylamino)methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 28619927 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-[(1,3-benzodioxol-5-ylamino)methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1cc(CNc2ccc3c(c2)OCO3)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H15N3O4/c1-16-7-9(13(18)17(2)14(16)19)6-15-10-3-4-11-12(5-10)21-8-20-11/h3-5,7,15H,6,8H2,1-2H3 |
| InChIKey | VJLUSELZHCGCQQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|