C16H13NO3 — CID 80700752
N-(1-benzofuran-3-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 80700752) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is N-(1-benzofuran-3-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(1-benzofuran-3-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 80700752 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-(1-benzofuran-3-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | c1ccc2c(CNc3ccc4c(c3)OCO4)coc2c1 |
| InChI | InChI=1S/C16H13NO3/c1-2-4-14-13(3-1)11(9-18-14)8-17-12-5-6-15-16(7-12)20-10-19-15/h1-7,9,17H,8,10H2 |
| InChIKey | FQFPKLYYWAZVIJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|