C15H10F3NO — CID 80701760
N-(1-benzofuran-3-ylmethyl)-2,4,6-trifluoroaniline (PubChem CID 80701760) has the molecular formula C15H10F3NO and a molecular weight of 277.25 g/mol. Its IUPAC name is N-(1-benzofuran-3-ylmethyl)-2,4,6-trifluoroaniline.
| Compound Name | N-(1-benzofuran-3-ylmethyl)-2,4,6-trifluoroaniline |
|---|---|
| PubChem CID | 80701760 |
| Molecular Formula | C15H10F3NO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(1-benzofuran-3-ylmethyl)-2,4,6-trifluoroaniline |
| SMILES | Fc1cc(F)c(NCc2coc3ccccc23)c(F)c1 |
| InChI | InChI=1S/C15H10F3NO/c16-10-5-12(17)15(13(18)6-10)19-7-9-8-20-14-4-2-1-3-11(9)14/h1-6,8,19H,7H2 |
| InChIKey | QCPVZIMSFZYCRT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |