C22H22N3O5+ — CID 73485057
5-(1,3-benzodioxol-5-yl)-1,3,8,8-tetramethyl-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione (PubChem CID 73485057) has the molecular formula C22H22N3O5+ and a molecular weight of 408.43 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1,3,8,8-tetramethyl-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1,3,8,8-tetramethyl-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione |
|---|---|
| PubChem CID | 73485057 |
| Molecular Formula | C22H22N3O5+ |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1,3,8,8-tetramethyl-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione |
| SMILES | Cn1c(=O)c2c(-c3ccc4c(c3)OCO4)c3c([nH+]c2n(C)c1=O)CC(C)(C)CC3=O |
| InChI | InChI=1S/C22H21N3O5/c1-22(2)8-12-17(13(26)9-22)16(11-5-6-14-15(7-11)30-10-29-14)18-19(23-12)24(3)21(28)25(4)20(18)27/h5-7H,8-10H2,1-4H3/p+1 |
| InChIKey | DEHVUOAWRMUPSA-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |