C22H24N3O3+ — CID 73485077
1,3,8,8-tetramethyl-5-(3-methylphenyl)-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione (PubChem CID 73485077) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is 1,3,8,8-tetramethyl-5-(3-methylphenyl)-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione.
| Compound Name | 1,3,8,8-tetramethyl-5-(3-methylphenyl)-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione |
|---|---|
| PubChem CID | 73485077 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1,3,8,8-tetramethyl-5-(3-methylphenyl)-7,9-dihydropyrimido[4,5-b]quinolin-10-ium-2,4,6-trione |
| SMILES | Cc1cccc(-c2c3c([nH+]c4c2c(=O)n(C)c(=O)n4C)CC(C)(C)CC3=O)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-12-7-6-8-13(9-12)16-17-14(10-22(2,3)11-15(17)26)23-19-18(16)20(27)25(5)21(28)24(19)4/h6-9H,10-11H2,1-5H3/p+1 |
| InChIKey | ZAKRBHUZTIHJCK-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |