C21H18N4O4 — CID 1422375
1,3-dimethyl-5-(3-methylphenyl)-6-(3-nitrophenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 1422375) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-methylphenyl)-6-(3-nitrophenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(3-methylphenyl)-6-(3-nitrophenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1422375 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1,3-dimethyl-5-(3-methylphenyl)-6-(3-nitrophenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cc1cccc(-c2c3c(=O)n(C)c(=O)n(C)c3cn2-c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H18N4O4/c1-13-6-4-7-14(10-13)19-18-17(22(2)21(27)23(3)20(18)26)12-24(19)15-8-5-9-16(11-15)25(28)29/h4-12H,1-3H3 |
| InChIKey | KBLVVTKFNALOAR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|