C20H16BrN5O4 — CID 4893146
6-(2-aminophenyl)-5-(2-bromo-5-nitrophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 4893146) has the molecular formula C20H16BrN5O4 and a molecular weight of 470.28 g/mol. Its IUPAC name is 6-(2-aminophenyl)-5-(2-bromo-5-nitrophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-aminophenyl)-5-(2-bromo-5-nitrophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4893146 |
| Molecular Formula | C20H16BrN5O4 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 6-(2-aminophenyl)-5-(2-bromo-5-nitrophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(-c3cc([N+](=O)[O-])ccc3Br)n(-c3ccccc3N)cc2n(C)c1=O |
| InChI | InChI=1S/C20H16BrN5O4/c1-23-16-10-25(15-6-4-3-5-14(15)22)18(17(16)19(27)24(2)20(23)28)12-9-11(26(29)30)7-8-13(12)21/h3-10H,22H2,1-2H3 |
| InChIKey | PTPYAWXXNUBETL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|