C23H22N4O6 — CID 41008261
6-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 41008261) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 6-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 41008261 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)n([C@H](CO)[C@H](O)c3ccc([N+](=O)[O-])cc3)cc2n(C)c1=O |
| InChI | InChI=1S/C23H22N4O6/c1-24-17-12-26(18(13-28)21(29)15-8-10-16(11-9-15)27(32)33)20(14-6-4-3-5-7-14)19(17)22(30)25(2)23(24)31/h3-12,18,21,28-29H,13H2,1-2H3/t18-,21-/m1/s1 |
| InChIKey | WFXHFGYKEVRFRN-WIYYLYMNSA-N |
| XLogP | 1.88 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|