C16H14BrN5O5 — CID 4895134
2-[5-(2-bromo-5-nitrophenyl)-1,3-dimethyl-2,4-dioxopyrrolo[3,4-d]pyrimidin-6-yl]acetamide (PubChem CID 4895134) has the molecular formula C16H14BrN5O5 and a molecular weight of 436.22 g/mol. Its IUPAC name is 2-[5-(2-bromo-5-nitrophenyl)-1,3-dimethyl-2,4-dioxopyrrolo[3,4-d]pyrimidin-6-yl]acetamide.
| Compound Name | 2-[5-(2-bromo-5-nitrophenyl)-1,3-dimethyl-2,4-dioxopyrrolo[3,4-d]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 4895134 |
| Molecular Formula | C16H14BrN5O5 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 2-[5-(2-bromo-5-nitrophenyl)-1,3-dimethyl-2,4-dioxopyrrolo[3,4-d]pyrimidin-6-yl]acetamide |
| SMILES | Cn1c(=O)c2c(-c3cc([N+](=O)[O-])ccc3Br)n(CC(N)=O)cc2n(C)c1=O |
| InChI | InChI=1S/C16H14BrN5O5/c1-19-11-6-21(7-12(18)23)14(13(11)15(24)20(2)16(19)25)9-5-8(22(26)27)3-4-10(9)17/h3-6H,7H2,1-2H3,(H2,18,23) |
| InChIKey | CDPAMJMAOCILHE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|