C22H19BrN4O6 — CID 4970517
5-(2-bromo-5-nitrophenyl)-6-(2,5-dimethoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 4970517) has the molecular formula C22H19BrN4O6 and a molecular weight of 515.32 g/mol. Its IUPAC name is 5-(2-bromo-5-nitrophenyl)-6-(2,5-dimethoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 5-(2-bromo-5-nitrophenyl)-6-(2,5-dimethoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4970517 |
| Molecular Formula | C22H19BrN4O6 |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 5-(2-bromo-5-nitrophenyl)-6-(2,5-dimethoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(OC)c(-n2cc3c(c2-c2cc([N+](=O)[O-])ccc2Br)c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C22H19BrN4O6/c1-24-17-11-26(16-10-13(32-3)6-8-18(16)33-4)20(19(17)21(28)25(2)22(24)29)14-9-12(27(30)31)5-7-15(14)23/h5-11H,1-4H3 |
| InChIKey | XJCJKPYDERCSDV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|