C24H19BrN4O2 — CID 4896706
6-(8-aminonaphthalen-1-yl)-5-(2-bromophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 4896706) has the molecular formula C24H19BrN4O2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 6-(8-aminonaphthalen-1-yl)-5-(2-bromophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-(8-aminonaphthalen-1-yl)-5-(2-bromophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4896706 |
| Molecular Formula | C24H19BrN4O2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 6-(8-aminonaphthalen-1-yl)-5-(2-bromophenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3Br)n(-c3cccc4cccc(N)c34)cc2n(C)c1=O |
| InChI | InChI=1S/C24H19BrN4O2/c1-27-19-13-29(18-12-6-8-14-7-5-11-17(26)20(14)18)22(15-9-3-4-10-16(15)25)21(19)23(30)28(2)24(27)31/h3-13H,26H2,1-2H3 |
| InChIKey | HNHJVAFJOMLKGT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|