C21H20N4O2 — CID 4871071
6-(3-aminophenyl)-1,3-dimethyl-5-(2-methylphenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 4871071) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 6-(3-aminophenyl)-1,3-dimethyl-5-(2-methylphenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-(3-aminophenyl)-1,3-dimethyl-5-(2-methylphenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4871071 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6-(3-aminophenyl)-1,3-dimethyl-5-(2-methylphenyl)pyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccccc1-c1c2c(=O)n(C)c(=O)n(C)c2cn1-c1cccc(N)c1 |
| InChI | InChI=1S/C21H20N4O2/c1-13-7-4-5-10-16(13)19-18-17(23(2)21(27)24(3)20(18)26)12-25(19)15-9-6-8-14(22)11-15/h4-12H,22H2,1-3H3 |
| InChIKey | HAYAWONICGWBHH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|