C25H22N4O3 — CID 2044425
6-(8-aminonaphthalen-1-yl)-5-(4-methoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 2044425) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 6-(8-aminonaphthalen-1-yl)-5-(4-methoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-(8-aminonaphthalen-1-yl)-5-(4-methoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2044425 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-(8-aminonaphthalen-1-yl)-5-(4-methoxyphenyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3cn2-c2cccc3cccc(N)c23)cc1 |
| InChI | InChI=1S/C25H22N4O3/c1-27-20-14-29(19-9-5-7-15-6-4-8-18(26)21(15)19)23(16-10-12-17(32-3)13-11-16)22(20)24(30)28(2)25(27)31/h4-14H,26H2,1-3H3 |
| InChIKey | VLVNBZWUMGYZLV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|