C24H27N3O6 — CID 73485084
1,3,8,8-tetramethyl-5-(3,4,5-trimethoxyphenyl)-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 73485084) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 1,3,8,8-tetramethyl-5-(3,4,5-trimethoxyphenyl)-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 1,3,8,8-tetramethyl-5-(3,4,5-trimethoxyphenyl)-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 73485084 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1,3,8,8-tetramethyl-5-(3,4,5-trimethoxyphenyl)-7,9-dihydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | COc1cc(-c2c3c(nc4c2c(=O)n(C)c(=O)n4C)CC(C)(C)CC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N3O6/c1-24(2)10-13-18(14(28)11-24)17(12-8-15(31-5)20(33-7)16(9-12)32-6)19-21(25-13)26(3)23(30)27(4)22(19)29/h8-9H,10-11H2,1-7H3 |
| InChIKey | WIMBQCRWGXUNRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |