C14H13NO7 — CID 134249359
2-(acetyloxymethyl)-5-methoxy-1-methyl-4,7-dioxoindole-3-carboxylic acid (PubChem CID 134249359) has the molecular formula C14H13NO7 and a molecular weight of 307.26 g/mol. Its IUPAC name is 2-(acetyloxymethyl)-5-methoxy-1-methyl-4,7-dioxoindole-3-carboxylic acid.
| Compound Name | 2-(acetyloxymethyl)-5-methoxy-1-methyl-4,7-dioxoindole-3-carboxylic acid |
|---|---|
| PubChem CID | 134249359 |
| Molecular Formula | C14H13NO7 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-(acetyloxymethyl)-5-methoxy-1-methyl-4,7-dioxoindole-3-carboxylic acid |
| SMILES | COC1=CC(=O)c2c(c(C(=O)O)c(COC(C)=O)n2C)C1=O |
| InChI | InChI=1S/C14H13NO7/c1-6(16)22-5-7-10(14(19)20)11-12(15(7)2)8(17)4-9(21-3)13(11)18/h4H,5H2,1-3H3,(H,19,20) |
| InChIKey | MVDZWXRCJRWCJT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|