C23H21NO2 — CID 14866756
1,2-dimethyl-3-(2-phenylpropyl)benzo[f]indole-4,9-dione (PubChem CID 14866756) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-phenylpropyl)benzo[f]indole-4,9-dione.
| Compound Name | 1,2-dimethyl-3-(2-phenylpropyl)benzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 14866756 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1,2-dimethyl-3-(2-phenylpropyl)benzo[f]indole-4,9-dione |
| SMILES | Cc1c(CC(C)c2ccccc2)c2c(n1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H21NO2/c1-14(16-9-5-4-6-10-16)13-19-15(2)24(3)21-20(19)22(25)17-11-7-8-12-18(17)23(21)26/h4-12,14H,13H2,1-3H3 |
| InChIKey | KSERVKALPDIZFM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|