C22H25NO2 — CID 90890207
3,4-bis(2-phenylpropyl)-1H-pyrrole-2,5-diol (PubChem CID 90890207) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3,4-bis(2-phenylpropyl)-1H-pyrrole-2,5-diol.
| Compound Name | 3,4-bis(2-phenylpropyl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90890207 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3,4-bis(2-phenylpropyl)-1H-pyrrole-2,5-diol |
| SMILES | CC(Cc1c(O)[nH]c(O)c1CC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-15(17-9-5-3-6-10-17)13-19-20(22(25)23-21(19)24)14-16(2)18-11-7-4-8-12-18/h3-12,15-16,23-25H,13-14H2,1-2H3 |
| InChIKey | DMACSFBQDSCYLT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |