C15H9NO5 — CID 11482958
1-methyl-4,5,10-trioxobenzo[g]quinoline-3-carboxylic acid (PubChem CID 11482958) has the molecular formula C15H9NO5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 1-methyl-4,5,10-trioxobenzo[g]quinoline-3-carboxylic acid.
| Compound Name | 1-methyl-4,5,10-trioxobenzo[g]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11482958 |
| Molecular Formula | C15H9NO5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-methyl-4,5,10-trioxobenzo[g]quinoline-3-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H9NO5/c1-16-6-9(15(20)21)13(18)10-11(16)14(19)8-5-3-2-4-7(8)12(10)17/h2-6H,1H3,(H,20,21) |
| InChIKey | YASPURJSKUSYPW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|