C19H19NO4 — CID 57402275
ethyl 8-ethyl-2,3-dimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate (PubChem CID 57402275) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl 8-ethyl-2,3-dimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate.
| Compound Name | ethyl 8-ethyl-2,3-dimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 57402275 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl 8-ethyl-2,3-dimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCOC(=O)c1c2c(n3ccc(CC)cc13)C(=O)C(C)=C(C)C2=O |
| InChI | InChI=1S/C19H19NO4/c1-5-12-7-8-20-13(9-12)14(19(23)24-6-2)15-16(20)18(22)11(4)10(3)17(15)21/h7-9H,5-6H2,1-4H3 |
| InChIKey | GCLMLBZLGAXNRG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|