C26H14ClNO2 — CID 102263172
12-(3-chlorophenyl)-11-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1,3,5,7,9,12,15,17,19-nonaene-14,21-dione (PubChem CID 102263172) has the molecular formula C26H14ClNO2 and a molecular weight of 407.86 g/mol. Its IUPAC name is 12-(3-chlorophenyl)-11-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1,3,5,7,9,12,15,17,19-nonaene-14,21-dione.
| Compound Name | 12-(3-chlorophenyl)-11-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1,3,5,7,9,12,15,17,19-nonaene-14,21-dione |
|---|---|
| PubChem CID | 102263172 |
| Molecular Formula | C26H14ClNO2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 12-(3-chlorophenyl)-11-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1,3,5,7,9,12,15,17,19-nonaene-14,21-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(-c1cccc(Cl)c1)n1ccc3ccccc3c21 |
| InChI | InChI=1S/C26H14ClNO2/c27-17-8-5-7-16(14-17)23-21-22(26(30)20-11-4-3-10-19(20)25(21)29)24-18-9-2-1-6-15(18)12-13-28(23)24/h1-14H |
| InChIKey | MTZYWBHZDHQVLT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|