C17H11NO6 — CID 23132582
1-amino-4-methyl-9,10-dioxoanthracene-2,3-dicarboxylic acid (PubChem CID 23132582) has the molecular formula C17H11NO6 and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-amino-4-methyl-9,10-dioxoanthracene-2,3-dicarboxylic acid.
| Compound Name | 1-amino-4-methyl-9,10-dioxoanthracene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 23132582 |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-amino-4-methyl-9,10-dioxoanthracene-2,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)c(C(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11NO6/c1-6-9-11(13(18)12(17(23)24)10(6)16(21)22)15(20)8-5-3-2-4-7(8)14(9)19/h2-5H,18H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | DVGKVEDUHFAIMD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|